C14H21NO2 — CID 100975569
(3R,5R)-1-benzyl-3-ethylpiperidine-3,5-diol (PubChem CID 100975569) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (3R,5R)-1-benzyl-3-ethylpiperidine-3,5-diol.
| Compound Name | (3R,5R)-1-benzyl-3-ethylpiperidine-3,5-diol |
|---|---|
| PubChem CID | 100975569 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (3R,5R)-1-benzyl-3-ethylpiperidine-3,5-diol |
| SMILES | CC[C@@]1(O)C[C@@H](O)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H21NO2/c1-2-14(17)8-13(16)10-15(11-14)9-12-6-4-3-5-7-12/h3-7,13,16-17H,2,8-11H2,1H3/t13-,14-/m1/s1 |
| InChIKey | IXCVXJDATWAGDM-ZIAGYGMSSA-N |
| XLogP | 1.39 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |