C27H20BrN2P — CID 100975952
2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]benzene-1,4-dicarbonitrile (PubChem CID 100975952) has the molecular formula C27H20BrN2P and a molecular weight of 483.35 g/mol. Its IUPAC name is 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]benzene-1,4-dicarbonitrile.
| Compound Name | 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 100975952 |
| Molecular Formula | C27H20BrN2P |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]benzene-1,4-dicarbonitrile |
| SMILES | N#Cc1ccc(C#N)c(CP(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H20BrN2P/c28-31(25-10-4-1-5-11-25,26-12-6-2-7-13-26,27-14-8-3-9-15-27)21-24-18-22(19-29)16-17-23(24)20-30/h1-18H,21H2 |
| InChIKey | UEEZGELCTYFWNV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|