C12H12N2 — CID 86195160
2-(2-methylpropyl)benzene-1,4-dicarbonitrile (PubChem CID 86195160) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-(2-methylpropyl)benzene-1,4-dicarbonitrile.
| Compound Name | 2-(2-methylpropyl)benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 86195160 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-(2-methylpropyl)benzene-1,4-dicarbonitrile |
| SMILES | CC(C)Cc1cc(C#N)ccc1C#N |
| InChI | InChI=1S/C12H12N2/c1-9(2)5-12-6-10(7-13)3-4-11(12)8-14/h3-4,6,9H,5H2,1-2H3 |
| InChIKey | JXOPNDNFPZVLKM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |