C13H20O3 — CID 100977130
(1R)-1-[(3'S)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol (PubChem CID 100977130) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (1R)-1-[(3'S)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol.
| Compound Name | (1R)-1-[(3'S)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol |
|---|---|
| PubChem CID | 100977130 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (1R)-1-[(3'S)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol |
| SMILES | C[C@@H](O)[C@@H]1OOC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C13H20O3/c1-7(14)12-13(16-15-12)10-3-8-2-9(5-10)6-11(13)4-8/h7-12,14H,2-6H2,1H3/t7-,8?,9?,10?,11?,12+,13?/m1/s1 |
| InChIKey | RZJDGJXXINEQKN-IBPAHSCNSA-N |
| XLogP | 1.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|