C14H13N3O6S — CID 1009772
2-hydroxy-3-methyl-N'-(2-nitrophenyl)sulfonylbenzohydrazide (PubChem CID 1009772) has the molecular formula C14H13N3O6S and a molecular weight of 351.34 g/mol. Its IUPAC name is 2-hydroxy-3-methyl-N'-(2-nitrophenyl)sulfonylbenzohydrazide.
| Compound Name | 2-hydroxy-3-methyl-N'-(2-nitrophenyl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 1009772 |
| Molecular Formula | C14H13N3O6S |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2-hydroxy-3-methyl-N'-(2-nitrophenyl)sulfonylbenzohydrazide |
| SMILES | Cc1cccc(C(=O)NNS(=O)(=O)c2ccccc2[N+](=O)[O-])c1O |
| InChI | InChI=1S/C14H13N3O6S/c1-9-5-4-6-10(13(9)18)14(19)15-16-24(22,23)12-8-3-2-7-11(12)17(20)21/h2-8,16,18H,1H3,(H,15,19) |
| InChIKey | PUQWIDQHVHLEME-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|