C12H16N4O7S2 — CID 2766093
2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-(2-nitrophenyl)sulfonylacetohydrazide (PubChem CID 2766093) has the molecular formula C12H16N4O7S2 and a molecular weight of 392.42 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-(2-nitrophenyl)sulfonylacetohydrazide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-(2-nitrophenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 2766093 |
| Molecular Formula | C12H16N4O7S2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-(2-nitrophenyl)sulfonylacetohydrazide |
| SMILES | O=C(CN1CCS(=O)(=O)CC1)NNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N4O7S2/c17-12(9-15-5-7-24(20,21)8-6-15)13-14-25(22,23)11-4-2-1-3-10(11)16(18)19/h1-4,14H,5-9H2,(H,13,17) |
| InChIKey | ARXXFHSIXWUEGJ-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|