C16H17N3O6S — CID 3374896
2-(4-ethylphenoxy)-N'-(2-nitrophenyl)sulfonylacetohydrazide (PubChem CID 3374896) has the molecular formula C16H17N3O6S and a molecular weight of 379.39 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-N'-(2-nitrophenyl)sulfonylacetohydrazide.
| Compound Name | 2-(4-ethylphenoxy)-N'-(2-nitrophenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 3374896 |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2-(4-ethylphenoxy)-N'-(2-nitrophenyl)sulfonylacetohydrazide |
| SMILES | CCc1ccc(OCC(=O)NNS(=O)(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H17N3O6S/c1-2-12-7-9-13(10-8-12)25-11-16(20)17-18-26(23,24)15-6-4-3-5-14(15)19(21)22/h3-10,18H,2,11H2,1H3,(H,17,20) |
| InChIKey | DIXYBJKPPBOXTL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|