C28H48O11Si2 — CID 100978954
methyl (1R,4S,5R,6S,7R)-4-acetyloxy-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-11-oxo-2-prop-2-enyl-3,8,10,12-tetraoxatricyclo[5.3.3.01,7]tridecane-2-carboxylate (PubChem CID 100978954) has the molecular formula C28H48O11Si2 and a molecular weight of 616.85 g/mol. Its IUPAC name is methyl (1R,4S,5R,6S,7R)-4-acetyloxy-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-11-oxo-2-prop-2-enyl-3,8,10,12-tetraoxatricyclo[5.3.3.01,7]tridecane-2-carboxylate.
| Compound Name | methyl (1R,4S,5R,6S,7R)-4-acetyloxy-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-11-oxo-2-prop-2-enyl-3,8,10,12-tetraoxatricyclo[5.3.3.01,7]tridecane-2-carboxylate |
|---|---|
| PubChem CID | 100978954 |
| Molecular Formula | C28H48O11Si2 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | methyl (1R,4S,5R,6S,7R)-4-acetyloxy-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-11-oxo-2-prop-2-enyl-3,8,10,12-tetraoxatricyclo[5.3.3.01,7]tridecane-2-carboxylate |
| SMILES | C=CCC1(C(=O)OC)O[C@@H](OC(C)=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@]23COC(=O)[C@]12OCO3 |
| InChI | InChI=1S/C28H48O11Si2/c1-14-15-26(22(30)32-9)28-23(31)33-16-27(28,34-17-35-28)20(39-41(12,13)25(6,7)8)19(21(37-26)36-18(2)29)38-40(10,11)24(3,4)5/h14,19-21H,1,15-17H2,2-13H3/t19-,20+,21-,26?,27-,28+/m1/s1 |
| InChIKey | PEDQSSUFEQWYNZ-JGONDERKSA-N |
| XLogP | 4.21 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|