C26H44O10Si2 — CID 100978962
methyl 2-[(3aR,6aR)-6a-[(1R,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxohex-5-enyl]-4-oxo-6H-furo[3,4-d][1,3]dioxol-3a-yl]-2-oxoacetate (PubChem CID 100978962) has the molecular formula C26H44O10Si2 and a molecular weight of 572.80 g/mol. Its IUPAC name is methyl 2-[(3aR,6aR)-6a-[(1R,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxohex-5-enyl]-4-oxo-6H-furo[3,4-d][1,3]dioxol-3a-yl]-2-oxoacetate.
| Compound Name | methyl 2-[(3aR,6aR)-6a-[(1R,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxohex-5-enyl]-4-oxo-6H-furo[3,4-d][1,3]dioxol-3a-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 100978962 |
| Molecular Formula | C26H44O10Si2 |
| Molecular Weight | 572.80 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | methyl 2-[(3aR,6aR)-6a-[(1R,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxohex-5-enyl]-4-oxo-6H-furo[3,4-d][1,3]dioxol-3a-yl]-2-oxoacetate |
| SMILES | C=CCC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@]12COC(=O)[C@@]1(C(=O)C(=O)OC)OCO2 |
| InChI | InChI=1S/C26H44O10Si2/c1-13-14-17(27)18(35-37(9,10)23(2,3)4)20(36-38(11,12)24(5,6)7)25-15-32-22(30)26(25,34-16-33-25)19(28)21(29)31-8/h13,18,20H,1,14-16H2,2-12H3/t18-,20-,25-,26-/m1/s1 |
| InChIKey | HIWMCKABQYHFRN-SHKCYZCESA-N |
| XLogP | 3.69 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|