C23H40O10Si2 — CID 100978952
methyl 2-[(3aR,6aR)-6a-[(1R,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxopropyl]-4-oxo-6H-furo[3,4-d][1,3]dioxol-3a-yl]-2-oxoacetate (PubChem CID 100978952) has the molecular formula C23H40O10Si2 and a molecular weight of 532.74 g/mol. Its IUPAC name is methyl 2-[(3aR,6aR)-6a-[(1R,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxopropyl]-4-oxo-6H-furo[3,4-d][1,3]dioxol-3a-yl]-2-oxoacetate.
| Compound Name | methyl 2-[(3aR,6aR)-6a-[(1R,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxopropyl]-4-oxo-6H-furo[3,4-d][1,3]dioxol-3a-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 100978952 |
| Molecular Formula | C23H40O10Si2 |
| Molecular Weight | 532.74 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | methyl 2-[(3aR,6aR)-6a-[(1R,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxopropyl]-4-oxo-6H-furo[3,4-d][1,3]dioxol-3a-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)[C@]12OCO[C@@]1([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=O)O[Si](C)(C)C(C)(C)C)COC2=O |
| InChI | InChI=1S/C23H40O10Si2/c1-20(2,3)34(8,9)32-15(12-24)17(33-35(10,11)21(4,5)6)22-13-29-19(27)23(22,31-14-30-22)16(25)18(26)28-7/h12,15,17H,13-14H2,1-11H3/t15-,17-,22-,23-/m1/s1 |
| InChIKey | CSSMEPOFZHJLJU-CBGOGXAZSA-N |
| XLogP | 2.75 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.74 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|