C18H32O7Si — CID 102107415
methyl 4-[(3aR,4R,6aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-4-oxobutanoate (PubChem CID 102107415) has the molecular formula C18H32O7Si and a molecular weight of 388.53 g/mol. Its IUPAC name is methyl 4-[(3aR,4R,6aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[(3aR,4R,6aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 102107415 |
| Molecular Formula | C18H32O7Si |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | methyl 4-[(3aR,4R,6aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)OC[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H32O7Si/c1-16(2,3)26(7,8)25-18(13(19)9-10-14(20)21-6)15-12(11-22-18)23-17(4,5)24-15/h12,15H,9-11H2,1-8H3/t12-,15-,18+/m1/s1 |
| InChIKey | WAUUCUIIPQOWNF-DWQUBVKVSA-N |
| XLogP | 2.78 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|