C17H32O5Si — CID 162402950
2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-propanoyl-1,3-dioxolan-4-yl]propan-1-one (PubChem CID 162402950) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-propanoyl-1,3-dioxolan-4-yl]propan-1-one.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-propanoyl-1,3-dioxolan-4-yl]propan-1-one |
|---|---|
| PubChem CID | 162402950 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-propanoyl-1,3-dioxolan-4-yl]propan-1-one |
| SMILES | CCC(=O)[C@H]1OC(C)(C)O[C@H]1C(=O)C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O5Si/c1-10-12(18)14-15(21-17(6,7)20-14)13(19)11(2)22-23(8,9)16(3,4)5/h11,14-15H,10H2,1-9H3/t11?,14-,15+/m1/s1 |
| InChIKey | IUQJWQZRAYCFJK-JBAPVGOWSA-N |
| XLogP | 3.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|