C19H36O5Si — CID 11057796
(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-[(2R,3S)-2-methyl-1,4-dioxaspiro[4.5]decan-3-yl]propanal (PubChem CID 11057796) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-[(2R,3S)-2-methyl-1,4-dioxaspiro[4.5]decan-3-yl]propanal.
| Compound Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-[(2R,3S)-2-methyl-1,4-dioxaspiro[4.5]decan-3-yl]propanal |
|---|---|
| PubChem CID | 11057796 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-[(2R,3S)-2-methyl-1,4-dioxaspiro[4.5]decan-3-yl]propanal |
| SMILES | CO[C@@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC2(CCCCC2)O[C@@H]1C |
| InChI | InChI=1S/C19H36O5Si/c1-14-16(23-19(22-14)11-9-8-10-12-19)17(15(13-20)21-5)24-25(6,7)18(2,3)4/h13-17H,8-12H2,1-7H3/t14-,15+,16+,17-/m1/s1 |
| InChIKey | IFNVQLIQXFYVAY-LTIDMASMSA-N |
| XLogP | 4.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|