C24H40O12Si — CID 11124472
dimethyl (4S,5S)-4-[(1R)-1-[(4R,5R)-2,2-diethyl-5-formyl-1,3-dioxolan-4-yl]-2-ethoxy-2-oxo-1-trimethylsilyloxyethyl]-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 11124472) has the molecular formula C24H40O12Si and a molecular weight of 548.66 g/mol. Its IUPAC name is dimethyl (4S,5S)-4-[(1R)-1-[(4R,5R)-2,2-diethyl-5-formyl-1,3-dioxolan-4-yl]-2-ethoxy-2-oxo-1-trimethylsilyloxyethyl]-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | dimethyl (4S,5S)-4-[(1R)-1-[(4R,5R)-2,2-diethyl-5-formyl-1,3-dioxolan-4-yl]-2-ethoxy-2-oxo-1-trimethylsilyloxyethyl]-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11124472 |
| Molecular Formula | C24H40O12Si |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | dimethyl (4S,5S)-4-[(1R)-1-[(4R,5R)-2,2-diethyl-5-formyl-1,3-dioxolan-4-yl]-2-ethoxy-2-oxo-1-trimethylsilyloxyethyl]-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@](O[Si](C)(C)C)([C@@H]1OC(CC)(CC)O[C@H]1C=O)[C@@]1(C(=O)OC)OC(C)(C)O[C@@H]1C(=O)OC |
| InChI | InChI=1S/C24H40O12Si/c1-11-22(12-2)32-15(14-25)16(34-22)24(20(28)31-13-3,36-37(8,9)10)23(19(27)30-7)17(18(26)29-6)33-21(4,5)35-23/h14-17H,11-13H2,1-10H3/t15-,16+,17+,23+,24-/m0/s1 |
| InChIKey | RKIUYSGDUMCINL-POCMPKHNSA-N |
| XLogP | 1.88 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|