C23H46O7Si2 — CID 11762710
methyl (2S,3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolane-2-carboxylate (PubChem CID 11762710) has the molecular formula C23H46O7Si2 and a molecular weight of 490.79 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolane-2-carboxylate |
|---|---|
| PubChem CID | 11762710 |
| Molecular Formula | C23H46O7Si2 |
| Molecular Weight | 490.79 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | methyl (2S,3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@H]([C@H]2COC(C)(C)O2)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O7Si2/c1-21(2,3)31(10,11)29-17-16(15-14-26-23(7,8)28-15)27-19(20(24)25-9)18(17)30-32(12,13)22(4,5)6/h15-19H,14H2,1-13H3/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | OTXDYXNBYDZPHO-FQBWVUSXSA-N |
| XLogP | 4.86 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.79 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|