C17H30O7Si — CID 101333352
methyl 3-[(3aR,5S,6R,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-oxopropanoate (PubChem CID 101333352) has the molecular formula C17H30O7Si and a molecular weight of 374.51 g/mol. Its IUPAC name is methyl 3-[(3aR,5S,6R,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-oxopropanoate.
| Compound Name | methyl 3-[(3aR,5S,6R,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 101333352 |
| Molecular Formula | C17H30O7Si |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | methyl 3-[(3aR,5S,6R,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O7Si/c1-16(2,3)25(7,8)24-13-12(10(18)9-11(19)20-6)21-15-14(13)22-17(4,5)23-15/h12-15H,9H2,1-8H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | WUJLRAQSCMZXOB-LXTVHRRPSA-N |
| XLogP | 2.39 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|