C26H46O10Si2 — CID 100978956
methyl (1R,4S,5S,6S,7R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-11-oxo-4-prop-2-enyl-3,8,10,12-tetraoxatricyclo[5.3.3.01,7]tridecane-2-carboxylate (PubChem CID 100978956) has the molecular formula C26H46O10Si2 and a molecular weight of 574.82 g/mol. Its IUPAC name is methyl (1R,4S,5S,6S,7R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-11-oxo-4-prop-2-enyl-3,8,10,12-tetraoxatricyclo[5.3.3.01,7]tridecane-2-carboxylate.
| Compound Name | methyl (1R,4S,5S,6S,7R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-11-oxo-4-prop-2-enyl-3,8,10,12-tetraoxatricyclo[5.3.3.01,7]tridecane-2-carboxylate |
|---|---|
| PubChem CID | 100978956 |
| Molecular Formula | C26H46O10Si2 |
| Molecular Weight | 574.82 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | methyl (1R,4S,5S,6S,7R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-11-oxo-4-prop-2-enyl-3,8,10,12-tetraoxatricyclo[5.3.3.01,7]tridecane-2-carboxylate |
| SMILES | C=CC[C@@H]1OC(O)(C(=O)OC)[C@]23OCO[C@]2(COC3=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O10Si2/c1-13-14-17-18(35-37(9,10)22(2,3)4)19(36-38(11,12)23(5,6)7)24-15-31-20(27)25(24,33-16-32-24)26(29,34-17)21(28)30-8/h13,17-19,29H,1,14-16H2,2-12H3/t17-,18-,19-,24+,25+,26?/m0/s1 |
| InChIKey | RNDSXGSSZXUHSV-LEIVSQFTSA-N |
| XLogP | 3.64 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.82 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|