C23H42O10Si2 — CID 100978958
methyl (1S,4R,5R,6S,7R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-11-oxo-3,8,10,12-tetraoxatricyclo[5.3.3.01,7]tridecane-2-carboxylate (PubChem CID 100978958) has the molecular formula C23H42O10Si2 and a molecular weight of 534.75 g/mol. Its IUPAC name is methyl (1S,4R,5R,6S,7R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-11-oxo-3,8,10,12-tetraoxatricyclo[5.3.3.01,7]tridecane-2-carboxylate.
| Compound Name | methyl (1S,4R,5R,6S,7R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-11-oxo-3,8,10,12-tetraoxatricyclo[5.3.3.01,7]tridecane-2-carboxylate |
|---|---|
| PubChem CID | 100978958 |
| Molecular Formula | C23H42O10Si2 |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | methyl (1S,4R,5R,6S,7R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-11-oxo-3,8,10,12-tetraoxatricyclo[5.3.3.01,7]tridecane-2-carboxylate |
| SMILES | COC(=O)C1O[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@]23COC(=O)[C@]12OCO3 |
| InChI | InChI=1S/C23H42O10Si2/c1-20(2,3)34(8,9)32-14-15(33-35(10,11)21(4,5)6)22-12-28-19(26)23(22,30-13-29-22)16(18(25)27-7)31-17(14)24/h14-17,24H,12-13H2,1-11H3/t14-,15+,16?,17-,22-,23-/m1/s1 |
| InChIKey | XYQFFIHXYSWRTO-UMDGQBMYSA-N |
| XLogP | 2.70 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|