C22H44O7Si2 — CID 101362832
(3aS,6R,6aS)-6-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one (PubChem CID 101362832) has the molecular formula C22H44O7Si2 and a molecular weight of 476.76 g/mol. Its IUPAC name is (3aS,6R,6aS)-6-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aS,6R,6aS)-6-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 101362832 |
| Molecular Formula | C22H44O7Si2 |
| Molecular Weight | 476.76 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | (3aS,6R,6aS)-6-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)OC(=O)[C@@]2(CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H44O7Si2/c1-19(2,3)30(9,10)25-13-15(23)16-17-22(18(24)27-16,29-21(7,8)28-17)14-26-31(11,12)20(4,5)6/h15-17,23H,13-14H2,1-12H3/t15-,16-,17+,22+/m1/s1 |
| InChIKey | NFHJWPFPDIVQDV-FSNCLGKMSA-N |
| XLogP | 4.21 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.76 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|