C24H46O6Si — CID 11005013
(2S,3S,4S,5R,8S)-3-[tert-butyl(dimethyl)silyl]oxy-8-decyl-4-hydroxy-2-methoxy-1,7-dioxaspiro[4.4]nonan-6-one (PubChem CID 11005013) has the molecular formula C24H46O6Si and a molecular weight of 458.71 g/mol. Its IUPAC name is (2S,3S,4S,5R,8S)-3-[tert-butyl(dimethyl)silyl]oxy-8-decyl-4-hydroxy-2-methoxy-1,7-dioxaspiro[4.4]nonan-6-one.
| Compound Name | (2S,3S,4S,5R,8S)-3-[tert-butyl(dimethyl)silyl]oxy-8-decyl-4-hydroxy-2-methoxy-1,7-dioxaspiro[4.4]nonan-6-one |
|---|---|
| PubChem CID | 11005013 |
| Molecular Formula | C24H46O6Si |
| Molecular Weight | 458.71 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | (2S,3S,4S,5R,8S)-3-[tert-butyl(dimethyl)silyl]oxy-8-decyl-4-hydroxy-2-methoxy-1,7-dioxaspiro[4.4]nonan-6-one |
| SMILES | CCCCCCCCCC[C@H]1C[C@]2(O[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)C(=O)O1 |
| InChI | InChI=1S/C24H46O6Si/c1-8-9-10-11-12-13-14-15-16-18-17-24(22(26)28-18)20(25)19(21(27-5)29-24)30-31(6,7)23(2,3)4/h18-21,25H,8-17H2,1-7H3/t18-,19-,20-,21-,24+/m0/s1 |
| InChIKey | ZNNMOFNAILQSJG-IUVFILBMSA-N |
| XLogP | 5.33 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.71 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|