C29H40O6Si — CID 10097939
[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethoxy-3,4-dioxo-1-(4-phenylphenyl)butan-2-yl] 2,2-dimethylpropanoate (PubChem CID 10097939) has the molecular formula C29H40O6Si and a molecular weight of 512.72 g/mol. Its IUPAC name is [(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethoxy-3,4-dioxo-1-(4-phenylphenyl)butan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethoxy-3,4-dioxo-1-(4-phenylphenyl)butan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10097939 |
| Molecular Formula | C29H40O6Si |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | [(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethoxy-3,4-dioxo-1-(4-phenylphenyl)butan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CCOC(=O)C(=O)C(OC(=O)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H40O6Si/c1-10-33-26(31)23(30)25(34-27(32)28(2,3)4)24(35-36(8,9)29(5,6)7)22-18-16-21(17-19-22)20-14-12-11-13-15-20/h11-19,24-25H,10H2,1-9H3/t24-,25?/m1/s1 |
| InChIKey | BYQISZFEGIBTNP-IKOFQBKESA-N |
| XLogP | 6.51 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|