C32H52O6Si2 — CID 134962458
methyl (2S,4R)-6-[(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohex-3-en-1-yl]-2-methyl-3-oxo-4-phenylmethoxy-2-trimethylsilyloxyhept-6-enoate (PubChem CID 134962458) has the molecular formula C32H52O6Si2 and a molecular weight of 588.93 g/mol. Its IUPAC name is methyl (2S,4R)-6-[(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohex-3-en-1-yl]-2-methyl-3-oxo-4-phenylmethoxy-2-trimethylsilyloxyhept-6-enoate.
| Compound Name | methyl (2S,4R)-6-[(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohex-3-en-1-yl]-2-methyl-3-oxo-4-phenylmethoxy-2-trimethylsilyloxyhept-6-enoate |
|---|---|
| PubChem CID | 134962458 |
| Molecular Formula | C32H52O6Si2 |
| Molecular Weight | 588.93 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | methyl (2S,4R)-6-[(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohex-3-en-1-yl]-2-methyl-3-oxo-4-phenylmethoxy-2-trimethylsilyloxyhept-6-enoate |
| SMILES | C=C(C[C@@H](OCc1ccccc1)C(=O)[C@](C)(O[Si](C)(C)C)C(=O)OC)[C@@H]1CC=C(C)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C32H52O6Si2/c1-23-18-19-26(21-27(23)37-40(11,12)31(3,4)5)24(2)20-28(36-22-25-16-14-13-15-17-25)29(33)32(6,30(34)35-7)38-39(8,9)10/h13-18,26-28H,2,19-22H2,1,3-12H3/t26-,27-,28-,32+/m1/s1 |
| InChIKey | VIHIIMNLUSCPHB-UPVLHCIQSA-N |
| XLogP | 7.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.93 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|