C32H50O7Si2 — CID 134962461
methyl (2S,4R)-6-[(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-methylcyclopent-2-en-1-yl]-2-methyl-3-oxo-4-phenylmethoxy-2-trimethylsilyloxyhept-6-enoate (PubChem CID 134962461) has the molecular formula C32H50O7Si2 and a molecular weight of 602.92 g/mol. Its IUPAC name is methyl (2S,4R)-6-[(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-methylcyclopent-2-en-1-yl]-2-methyl-3-oxo-4-phenylmethoxy-2-trimethylsilyloxyhept-6-enoate.
| Compound Name | methyl (2S,4R)-6-[(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-methylcyclopent-2-en-1-yl]-2-methyl-3-oxo-4-phenylmethoxy-2-trimethylsilyloxyhept-6-enoate |
|---|---|
| PubChem CID | 134962461 |
| Molecular Formula | C32H50O7Si2 |
| Molecular Weight | 602.92 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | methyl (2S,4R)-6-[(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-methylcyclopent-2-en-1-yl]-2-methyl-3-oxo-4-phenylmethoxy-2-trimethylsilyloxyhept-6-enoate |
| SMILES | C=C(C[C@@H](OCc1ccccc1)C(=O)[C@](C)(O[Si](C)(C)C)C(=O)OC)[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C(C)=C1C=O |
| InChI | InChI=1S/C32H50O7Si2/c1-22(25-19-27(23(2)26(25)20-33)38-41(11,12)31(3,4)5)18-28(37-21-24-16-14-13-15-17-24)29(34)32(6,30(35)36-7)39-40(8,9)10/h13-17,20,25,27-28H,1,18-19,21H2,2-12H3/t25-,27-,28-,32+/m1/s1 |
| InChIKey | BJUWGDFVDALAAB-WLYVSXJZSA-N |
| XLogP | 6.80 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.92 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|