C32H50O6Si2 — CID 23248807
(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5-bis(phenylmethoxy)hexanedial (PubChem CID 23248807) has the molecular formula C32H50O6Si2 and a molecular weight of 586.92 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5-bis(phenylmethoxy)hexanedial.
| Compound Name | (2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5-bis(phenylmethoxy)hexanedial |
|---|---|
| PubChem CID | 23248807 |
| Molecular Formula | C32H50O6Si2 |
| Molecular Weight | 586.92 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | (2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5-bis(phenylmethoxy)hexanedial |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=O)OCc1ccccc1)[C@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H50O6Si2/c1-31(2,3)39(7,8)37-29(27(21-33)35-23-25-17-13-11-14-18-25)30(38-40(9,10)32(4,5)6)28(22-34)36-24-26-19-15-12-16-20-26/h11-22,27-30H,23-24H2,1-10H3/t27-,28-,29+,30+/m0/s1 |
| InChIKey | GMXAANSAOIVTAW-VZNYXHRGSA-N |
| XLogP | 7.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.92 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|