C23H40O4Si2 — CID 24749454
(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-phenyloxolane-2-carbaldehyde (PubChem CID 24749454) has the molecular formula C23H40O4Si2 and a molecular weight of 436.74 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-phenyloxolane-2-carbaldehyde.
| Compound Name | (2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-phenyloxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 24749454 |
| Molecular Formula | C23H40O4Si2 |
| Molecular Weight | 436.74 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-phenyloxolane-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](c2ccccc2)O[C@H]1C=O |
| InChI | InChI=1S/C23H40O4Si2/c1-22(2,3)28(7,8)26-20-18(16-24)25-19(17-14-12-11-13-15-17)21(20)27-29(9,10)23(4,5)6/h11-16,18-21H,1-10H3/t18-,19+,20+,21+/m0/s1 |
| InChIKey | MGEAAMCEAAHYCF-DOIPELPJSA-N |
| XLogP | 6.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.74 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|