C25H34O4S — CID 100982338
methyl (1R,11S,12S,13R,15S)-12-methyl-16-oxo-13-phenylsulfanyl-17-oxatricyclo[9.4.1.112,15]heptadecane-1-carboxylate (PubChem CID 100982338) has the molecular formula C25H34O4S and a molecular weight of 430.61 g/mol. Its IUPAC name is methyl (1R,11S,12S,13R,15S)-12-methyl-16-oxo-13-phenylsulfanyl-17-oxatricyclo[9.4.1.112,15]heptadecane-1-carboxylate.
| Compound Name | methyl (1R,11S,12S,13R,15S)-12-methyl-16-oxo-13-phenylsulfanyl-17-oxatricyclo[9.4.1.112,15]heptadecane-1-carboxylate |
|---|---|
| PubChem CID | 100982338 |
| Molecular Formula | C25H34O4S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | methyl (1R,11S,12S,13R,15S)-12-methyl-16-oxo-13-phenylsulfanyl-17-oxatricyclo[9.4.1.112,15]heptadecane-1-carboxylate |
| SMILES | COC(=O)[C@@]12CCCCCCCCC[C@H](C1=O)[C@]1(C)O[C@H]2C[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C25H34O4S/c1-24-19-15-11-6-4-3-5-7-12-16-25(22(19)26,23(27)28-2)20(29-24)17-21(24)30-18-13-9-8-10-14-18/h8-10,13-14,19-21H,3-7,11-12,15-17H2,1-2H3/t19-,20+,21-,24+,25-/m1/s1 |
| InChIKey | NCSMNMOMXNZYCB-DCDJFBNSSA-N |
| XLogP | 5.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|