C22H36O4 — CID 100982341
methyl (1R,11S,12R,16S)-17-oxo-12-propyl-18-oxatricyclo[9.5.1.112,16]octadecane-1-carboxylate (PubChem CID 100982341) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is methyl (1R,11S,12R,16S)-17-oxo-12-propyl-18-oxatricyclo[9.5.1.112,16]octadecane-1-carboxylate.
| Compound Name | methyl (1R,11S,12R,16S)-17-oxo-12-propyl-18-oxatricyclo[9.5.1.112,16]octadecane-1-carboxylate |
|---|---|
| PubChem CID | 100982341 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | methyl (1R,11S,12R,16S)-17-oxo-12-propyl-18-oxatricyclo[9.5.1.112,16]octadecane-1-carboxylate |
| SMILES | CCC[C@]12CCC[C@H](O1)[C@]1(C(=O)OC)CCCCCCCCC[C@@H]2C1=O |
| InChI | InChI=1S/C22H36O4/c1-3-14-21-15-11-13-18(26-21)22(20(24)25-2)16-10-8-6-4-5-7-9-12-17(21)19(22)23/h17-18H,3-16H2,1-2H3/t17-,18+,21-,22-/m1/s1 |
| InChIKey | YXGPBHBDONXGKZ-GMQQQROESA-N |
| XLogP | 4.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|