C12H14F8INO4S — CID 100983148
N-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethyl]sulfonylcycloheptanecarboxamide (PubChem CID 100983148) has the molecular formula C12H14F8INO4S and a molecular weight of 547.20 g/mol. Its IUPAC name is N-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethyl]sulfonylcycloheptanecarboxamide.
| Compound Name | N-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethyl]sulfonylcycloheptanecarboxamide |
|---|---|
| PubChem CID | 100983148 |
| Molecular Formula | C12H14F8INO4S |
| Molecular Weight | 547.20 g/mol |
| Exact Mass | 546.96 |
| IUPAC Name | N-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethyl]sulfonylcycloheptanecarboxamide |
| SMILES | O=C(NS(=O)(=O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)I)C1CCCCCC1 |
| InChI | InChI=1S/C12H14F8INO4S/c13-9(14,21)10(15,16)26-11(17,18)12(19,20)27(24,25)22-8(23)7-5-3-1-2-4-6-7/h7H,1-6H2,(H,22,23) |
| InChIKey | DDVIZTRUTSBUAY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.20 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|