C7H10F3NO3S — CID 100983151
N-(trifluoromethylsulfonyl)cyclopentanecarboxamide (PubChem CID 100983151) has the molecular formula C7H10F3NO3S and a molecular weight of 245.22 g/mol. Its IUPAC name is N-(trifluoromethylsulfonyl)cyclopentanecarboxamide.
| Compound Name | N-(trifluoromethylsulfonyl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 100983151 |
| Molecular Formula | C7H10F3NO3S |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | N-(trifluoromethylsulfonyl)cyclopentanecarboxamide |
| SMILES | O=C(NS(=O)(=O)C(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C7H10F3NO3S/c8-7(9,10)15(13,14)11-6(12)5-3-1-2-4-5/h5H,1-4H2,(H,11,12) |
| InChIKey | NITHTSLTEGSOGU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |