C20H33ClN2O3 — CID 100983317
tert-butyl (2S)-2-[(3S,4R)-6-chloro-4-(pyrrolidine-1-carbonyl)hex-1-en-3-yl]pyrrolidine-1-carboxylate (PubChem CID 100983317) has the molecular formula C20H33ClN2O3 and a molecular weight of 384.95 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3S,4R)-6-chloro-4-(pyrrolidine-1-carbonyl)hex-1-en-3-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(3S,4R)-6-chloro-4-(pyrrolidine-1-carbonyl)hex-1-en-3-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100983317 |
| Molecular Formula | C20H33ClN2O3 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | tert-butyl (2S)-2-[(3S,4R)-6-chloro-4-(pyrrolidine-1-carbonyl)hex-1-en-3-yl]pyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]([C@@H](CCCl)C(=O)N1CCCC1)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33ClN2O3/c1-5-15(16(10-11-21)18(24)22-12-6-7-13-22)17-9-8-14-23(17)19(25)26-20(2,3)4/h5,15-17H,1,6-14H2,2-4H3/t15-,16+,17-/m0/s1 |
| InChIKey | RNIQPHVXJUZUHN-BBWFWOEESA-N |
| XLogP | 4.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|