C18H29ClN2O3 — CID 100983319
tert-butyl (2S)-2-[(3R,4R)-4-chloro-5-oxo-5-pyrrolidin-1-ylpent-1-en-3-yl]pyrrolidine-1-carboxylate (PubChem CID 100983319) has the molecular formula C18H29ClN2O3 and a molecular weight of 356.89 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3R,4R)-4-chloro-5-oxo-5-pyrrolidin-1-ylpent-1-en-3-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(3R,4R)-4-chloro-5-oxo-5-pyrrolidin-1-ylpent-1-en-3-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100983319 |
| Molecular Formula | C18H29ClN2O3 |
| Molecular Weight | 356.89 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | tert-butyl (2S)-2-[(3R,4R)-4-chloro-5-oxo-5-pyrrolidin-1-ylpent-1-en-3-yl]pyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]([C@@H](Cl)C(=O)N1CCCC1)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29ClN2O3/c1-5-13(15(19)16(22)20-10-6-7-11-20)14-9-8-12-21(14)17(23)24-18(2,3)4/h5,13-15H,1,6-12H2,2-4H3/t13-,14+,15-/m1/s1 |
| InChIKey | NWSMOYWVNSEUEA-QLFBSQMISA-N |
| XLogP | 3.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.89 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|