C20H32N2O3 — CID 100983318
tert-butyl (2S)-2-[(3S,4R)-4-(pyrrolidine-1-carbonyl)hexa-1,5-dien-3-yl]pyrrolidine-1-carboxylate (PubChem CID 100983318) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3S,4R)-4-(pyrrolidine-1-carbonyl)hexa-1,5-dien-3-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(3S,4R)-4-(pyrrolidine-1-carbonyl)hexa-1,5-dien-3-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100983318 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | tert-butyl (2S)-2-[(3S,4R)-4-(pyrrolidine-1-carbonyl)hexa-1,5-dien-3-yl]pyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]([C@@H](C=C)C(=O)N1CCCC1)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32N2O3/c1-6-15(16(7-2)18(23)21-12-8-9-13-21)17-11-10-14-22(17)19(24)25-20(3,4)5/h6-7,15-17H,1-2,8-14H2,3-5H3/t15-,16+,17-/m0/s1 |
| InChIKey | SSYJCEHPPRSUDT-BBWFWOEESA-N |
| XLogP | 3.61 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|