C30H26Cl2N2O2 — CID 100983963
N-[2-[4-[2-(benzylideneamino)-5-chlorophenoxy]butoxy]-4-chlorophenyl]-1-phenylmethanimine (PubChem CID 100983963) has the molecular formula C30H26Cl2N2O2 and a molecular weight of 517.46 g/mol. Its IUPAC name is N-[2-[4-[2-(benzylideneamino)-5-chlorophenoxy]butoxy]-4-chlorophenyl]-1-phenylmethanimine.
| Compound Name | N-[2-[4-[2-(benzylideneamino)-5-chlorophenoxy]butoxy]-4-chlorophenyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 100983963 |
| Molecular Formula | C30H26Cl2N2O2 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | N-[2-[4-[2-(benzylideneamino)-5-chlorophenoxy]butoxy]-4-chlorophenyl]-1-phenylmethanimine |
| SMILES | Clc1ccc(/N=C/c2ccccc2)c(OCCCCOc2cc(Cl)ccc2/N=C/c2ccccc2)c1 |
| InChI | InChI=1S/C30H26Cl2N2O2/c31-25-13-15-27(33-21-23-9-3-1-4-10-23)29(19-25)35-17-7-8-18-36-30-20-26(32)14-16-28(30)34-22-24-11-5-2-6-12-24/h1-6,9-16,19-22H,7-8,17-18H2/b33-21+,34-22+ |
| InChIKey | ZGECDINAXWWSSR-WXGDAXOSSA-N |
| XLogP | 8.73 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|