C20H24N4O4 — CID 100984174
3-methyl-6-nitro-10-octylpyrimido[4,5-b]quinoline-2,4-dione (PubChem CID 100984174) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-methyl-6-nitro-10-octylpyrimido[4,5-b]quinoline-2,4-dione.
| Compound Name | 3-methyl-6-nitro-10-octylpyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| PubChem CID | 100984174 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-methyl-6-nitro-10-octylpyrimido[4,5-b]quinoline-2,4-dione |
| SMILES | CCCCCCCCn1c2nc(=O)n(C)c(=O)c-2cc2c([N+](=O)[O-])cccc21 |
| InChI | InChI=1S/C20H24N4O4/c1-3-4-5-6-7-8-12-23-16-10-9-11-17(24(27)28)14(16)13-15-18(23)21-20(26)22(2)19(15)25/h9-11,13H,3-8,12H2,1-2H3 |
| InChIKey | QDAOQSCJEAHBME-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 100.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|