C19H29NO3SSi — CID 100985225
2-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]-2-triethylsilylethenone (PubChem CID 100985225) has the molecular formula C19H29NO3SSi and a molecular weight of 379.60 g/mol. Its IUPAC name is 2-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]-2-triethylsilylethenone.
| Compound Name | 2-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]-2-triethylsilylethenone |
|---|---|
| PubChem CID | 100985225 |
| Molecular Formula | C19H29NO3SSi |
| Molecular Weight | 379.60 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]-2-triethylsilylethenone |
| SMILES | CC[Si](CC)(CC)C(=C=O)[C@@H]1CCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H29NO3SSi/c1-5-25(6-2,7-3)19(15-21)18-9-8-14-20(18)24(22,23)17-12-10-16(4)11-13-17/h10-13,18H,5-9,14H2,1-4H3/t18-/m0/s1 |
| InChIKey | DJRPZEOFJKEVCX-SFHVURJKSA-N |
| XLogP | 3.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|