C33H37N5O10 — CID 100985478
methyl (2S)-3-(4-hydroxy-2-nitrophenyl)-2-[[(2S)-3-phenyl-2-[[(2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoate (PubChem CID 100985478) has the molecular formula C33H37N5O10 and a molecular weight of 663.68 g/mol. Its IUPAC name is methyl (2S)-3-(4-hydroxy-2-nitrophenyl)-2-[[(2S)-3-phenyl-2-[[(2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoate.
| Compound Name | methyl (2S)-3-(4-hydroxy-2-nitrophenyl)-2-[[(2S)-3-phenyl-2-[[(2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 100985478 |
| Molecular Formula | C33H37N5O10 |
| Molecular Weight | 663.68 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | methyl (2S)-3-(4-hydroxy-2-nitrophenyl)-2-[[(2S)-3-phenyl-2-[[(2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1[N+](=O)[O-])NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H37N5O10/c1-20(34-29(40)21(2)35-33(44)48-19-23-12-8-5-9-13-23)30(41)36-26(16-22-10-6-4-7-11-22)31(42)37-27(32(43)47-3)17-24-14-15-25(39)18-28(24)38(45)46/h4-15,18,20-21,26-27,39H,16-17,19H2,1-3H3,(H,34,40)(H,35,44)(H,36,41)(H,37,42)/t20-,21-,26-,27-/m0/s1 |
| InChIKey | VJVLOFKPYJTYHM-YDNHHRFVSA-N |
| XLogP | 2.05 |
| TPSA | 215.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.68 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|