C24H31NO3 — CID 100986400
(1S,2S,6R,14R,15R,18R,19R)-5,17,17,18-tetramethyl-13,16-dioxa-5-azaheptacyclo[13.5.2.12,8.01,6.02,14.015,19.012,23]tricosa-8(23),9,11-trien-11-ol (PubChem CID 100986400) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is (1S,2S,6R,14R,15R,18R,19R)-5,17,17,18-tetramethyl-13,16-dioxa-5-azaheptacyclo[13.5.2.12,8.01,6.02,14.015,19.012,23]tricosa-8(23),9,11-trien-11-ol.
| Compound Name | (1S,2S,6R,14R,15R,18R,19R)-5,17,17,18-tetramethyl-13,16-dioxa-5-azaheptacyclo[13.5.2.12,8.01,6.02,14.015,19.012,23]tricosa-8(23),9,11-trien-11-ol |
|---|---|
| PubChem CID | 100986400 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (1S,2S,6R,14R,15R,18R,19R)-5,17,17,18-tetramethyl-13,16-dioxa-5-azaheptacyclo[13.5.2.12,8.01,6.02,14.015,19.012,23]tricosa-8(23),9,11-trien-11-ol |
| SMILES | C[C@@H]1[C@H]2C[C@@]34CC[C@]2(OC1(C)C)[C@@H]1Oc2c(O)ccc5c2[C@@]13CCN(C)[C@@H]4C5 |
| InChI | InChI=1S/C24H31NO3/c1-13-15-12-22-7-8-24(15,28-21(13,2)3)20-23(22)9-10-25(4)17(22)11-14-5-6-16(26)19(27-20)18(14)23/h5-6,13,15,17,20,26H,7-12H2,1-4H3/t13-,15-,17-,20-,22-,23+,24-/m1/s1 |
| InChIKey | NXPVKARTMAUCTN-YVPHUZCISA-N |
| XLogP | 3.63 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |