C22H30N4O2Se2 — CID 10098789
3-[(1R)-1-[2-[[2-[(1R)-1-(dimethylcarbamoylamino)ethyl]phenyl]diselanyl]phenyl]ethyl]-1,1-dimethylurea (PubChem CID 10098789) has the molecular formula C22H30N4O2Se2 and a molecular weight of 540.43 g/mol. Its IUPAC name is 3-[(1R)-1-[2-[[2-[(1R)-1-(dimethylcarbamoylamino)ethyl]phenyl]diselanyl]phenyl]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[(1R)-1-[2-[[2-[(1R)-1-(dimethylcarbamoylamino)ethyl]phenyl]diselanyl]phenyl]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 10098789 |
| Molecular Formula | C22H30N4O2Se2 |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | 3-[(1R)-1-[2-[[2-[(1R)-1-(dimethylcarbamoylamino)ethyl]phenyl]diselanyl]phenyl]ethyl]-1,1-dimethylurea |
| SMILES | C[C@@H](NC(=O)N(C)C)c1ccccc1[Se][Se]c1ccccc1[C@@H](C)NC(=O)N(C)C |
| InChI | InChI=1S/C22H30N4O2Se2/c1-15(23-21(27)25(3)4)17-11-7-9-13-19(17)29-30-20-14-10-8-12-18(20)16(2)24-22(28)26(5)6/h7-16H,1-6H3,(H,23,27)(H,24,28)/t15-,16-/m1/s1 |
| InChIKey | ZRBZLXULYJFZCY-HZPDHXFCSA-N |
| XLogP | 1.63 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|