C9H15N3O — CID 130621343
1,1-dimethyl-3-[1-(1H-pyrrol-2-yl)ethyl]urea (PubChem CID 130621343) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 1,1-dimethyl-3-[1-(1H-pyrrol-2-yl)ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[1-(1H-pyrrol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 130621343 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 1,1-dimethyl-3-[1-(1H-pyrrol-2-yl)ethyl]urea |
| SMILES | CC(NC(=O)N(C)C)c1ccc[nH]1 |
| InChI | InChI=1S/C9H15N3O/c1-7(8-5-4-6-10-8)11-9(13)12(2)3/h4-7,10H,1-3H3,(H,11,13) |
| InChIKey | UIEVVECTJUPSPQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |