C8H13N3O — CID 116850119
2-amino-N,N-dimethyl-2-(1H-pyrrol-2-yl)acetamide (PubChem CID 116850119) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-amino-N,N-dimethyl-2-(1H-pyrrol-2-yl)acetamide.
| Compound Name | 2-amino-N,N-dimethyl-2-(1H-pyrrol-2-yl)acetamide |
|---|---|
| PubChem CID | 116850119 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-amino-N,N-dimethyl-2-(1H-pyrrol-2-yl)acetamide |
| SMILES | CN(C)C(=O)C(N)c1ccc[nH]1 |
| InChI | InChI=1S/C8H13N3O/c1-11(2)8(12)7(9)6-4-3-5-10-6/h3-5,7,10H,9H2,1-2H3 |
| InChIKey | QGJPEHBVDWHBLL-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |