About 1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate
1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate (PubChem CID 10105075) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is 1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate |
| PubChem CID | 10105075 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate |
| SMILES | COC(=O)C(C(=O)OC(C)C)c1ccc[nH]1 |
| InChI | InChI=1S/C11H15NO4/c1-7(2)16-11(14)9(10(13)15-3)8-5-4-6-12-8/h4-7,9,12H,1-3H3 |
| InChIKey | FAHYUYWSZCWLIJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate?
The IUPAC name of 1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate (CID 10105075) is 1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate.
What is the SMILES notation for 1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate?
The canonical SMILES for 1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate is COC(=O)C(C(=O)OC(C)C)c1ccc[nH]1.
What is the InChIKey of 1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate?
The InChIKey is FAHYUYWSZCWLIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4/c1-7(2)16-11(14)9(10(13)15-3)8-5-4-6-12-8/h4-7,9,12H,1-3H3.
What are the key properties of 1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate?
1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate has a molecular weight of 225.24 g/mol, XLogP of 1.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 3-O-propan-2-yl 2-(1H-pyrrol-2-yl)propanedioate is sourced from PubChem (CID 10105075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).