C13H18ClNO4 — CID 10016938
3-O-tert-butyl 1-O-(2-chloroethyl) 2-(1H-pyrrol-2-yl)propanedioate (PubChem CID 10016938) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-(2-chloroethyl) 2-(1H-pyrrol-2-yl)propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-(2-chloroethyl) 2-(1H-pyrrol-2-yl)propanedioate |
|---|---|
| PubChem CID | 10016938 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-O-tert-butyl 1-O-(2-chloroethyl) 2-(1H-pyrrol-2-yl)propanedioate |
| SMILES | CC(C)(C)OC(=O)C(C(=O)OCCCl)c1ccc[nH]1 |
| InChI | InChI=1S/C13H18ClNO4/c1-13(2,3)19-12(17)10(9-5-4-7-15-9)11(16)18-8-6-14/h4-5,7,10,15H,6,8H2,1-3H3 |
| InChIKey | XUGIOYGDWSPIPF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|