C19H29NO5 — CID 57223565
9-O-tert-butyl 1-O-ethyl 7-oxo-3-(1H-pyrrol-2-yl)nonanedioate (PubChem CID 57223565) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is 9-O-tert-butyl 1-O-ethyl 7-oxo-3-(1H-pyrrol-2-yl)nonanedioate.
| Compound Name | 9-O-tert-butyl 1-O-ethyl 7-oxo-3-(1H-pyrrol-2-yl)nonanedioate |
|---|---|
| PubChem CID | 57223565 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 9-O-tert-butyl 1-O-ethyl 7-oxo-3-(1H-pyrrol-2-yl)nonanedioate |
| SMILES | CCOC(=O)CC(CCCC(=O)CC(=O)OC(C)(C)C)c1ccc[nH]1 |
| InChI | InChI=1S/C19H29NO5/c1-5-24-17(22)12-14(16-10-7-11-20-16)8-6-9-15(21)13-18(23)25-19(2,3)4/h7,10-11,14,20H,5-6,8-9,12-13H2,1-4H3 |
| InChIKey | ORXDXHHYDLYBRE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|