C6H4F6NNaO — CID 100988569
sodium (Z)-1,1,1,5,5,5-hexafluoro-4-methyliminopent-2-en-2-olate (PubChem CID 100988569) has the molecular formula C6H4F6NNaO and a molecular weight of 243.08 g/mol. Its IUPAC name is sodium (Z)-1,1,1,5,5,5-hexafluoro-4-methyliminopent-2-en-2-olate.
| Compound Name | sodium (Z)-1,1,1,5,5,5-hexafluoro-4-methyliminopent-2-en-2-olate |
|---|---|
| PubChem CID | 100988569 |
| Molecular Formula | C6H4F6NNaO |
| Molecular Weight | 243.08 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | sodium (Z)-1,1,1,5,5,5-hexafluoro-4-methyliminopent-2-en-2-olate |
| SMILES | C/N=C(/C=C(\[O-])C(F)(F)F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C6H5F6NO.Na/c1-13-3(5(7,8)9)2-4(14)6(10,11)12;/h2,14H,1H3;/q;+1/p-1/b4-2-,13-3-; |
| InChIKey | RIBWEYRQIWLLSS-LQQHKDOPSA-M |
| XLogP | -1.57 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.08 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|