C9H10F6NNaO — CID 100988572
sodium (Z)-4-butylimino-1,1,1,5,5,5-hexafluoropent-2-en-2-olate (PubChem CID 100988572) has the molecular formula C9H10F6NNaO and a molecular weight of 285.16 g/mol. Its IUPAC name is sodium (Z)-4-butylimino-1,1,1,5,5,5-hexafluoropent-2-en-2-olate.
| Compound Name | sodium (Z)-4-butylimino-1,1,1,5,5,5-hexafluoropent-2-en-2-olate |
|---|---|
| PubChem CID | 100988572 |
| Molecular Formula | C9H10F6NNaO |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | sodium (Z)-4-butylimino-1,1,1,5,5,5-hexafluoropent-2-en-2-olate |
| SMILES | CCCC/N=C(\C=C(/[O-])C(F)(F)F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C9H11F6NO.Na/c1-2-3-4-16-6(8(10,11)12)5-7(17)9(13,14)15;/h5,17H,2-4H2,1H3;/q;+1/p-1/b7-5-,16-6+; |
| InChIKey | NJVSZTBHCNIAHF-UJVNGJNASA-M |
| XLogP | -0.40 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|