C7H7F6NO — CID 72560388
1,1,1,5,5,5-hexafluoro-4-methoxy-N-methylpent-3-en-2-imine (PubChem CID 72560388) has the molecular formula C7H7F6NO and a molecular weight of 235.13 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-4-methoxy-N-methylpent-3-en-2-imine.
| Compound Name | 1,1,1,5,5,5-hexafluoro-4-methoxy-N-methylpent-3-en-2-imine |
|---|---|
| PubChem CID | 72560388 |
| Molecular Formula | C7H7F6NO |
| Molecular Weight | 235.13 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-4-methoxy-N-methylpent-3-en-2-imine |
| SMILES | C/N=C(/C=C(OC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H7F6NO/c1-14-4(6(8,9)10)3-5(15-2)7(11,12)13/h3H,1-2H3/b5-3?,14-4- |
| InChIKey | PNVWAMNUYDIBOQ-HZGFNKDHSA-N |
| XLogP | 2.71 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.13 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|