C10H12OS — CID 100990145
(1S,3S,5S,7S)-8-methylidene-2-thiatricyclo[3.3.1.13,7]decan-4-one (PubChem CID 100990145) has the molecular formula C10H12OS and a molecular weight of 180.27 g/mol. Its IUPAC name is (1S,3S,5S,7S)-8-methylidene-2-thiatricyclo[3.3.1.13,7]decan-4-one.
| Compound Name | (1S,3S,5S,7S)-8-methylidene-2-thiatricyclo[3.3.1.13,7]decan-4-one |
|---|---|
| PubChem CID | 100990145 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (1S,3S,5S,7S)-8-methylidene-2-thiatricyclo[3.3.1.13,7]decan-4-one |
| SMILES | C=C1[C@H]2C[C@H]3C[C@@H]1S[C@@H](C2)C3=O |
| InChI | InChI=1S/C10H12OS/c1-5-6-2-7-4-8(5)12-9(3-6)10(7)11/h6-9H,1-4H2/t6-,7-,8-,9-/m0/s1 |
| InChIKey | LBEUYUGVUSRGDE-JBDRJPRFSA-N |
| XLogP | 2.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|