C21H22F3NO3S — CID 100991718
tert-butyl (2S,3R)-1-(4-methylphenyl)sulfinyl-3-[4-(trifluoromethyl)phenyl]aziridine-2-carboxylate (PubChem CID 100991718) has the molecular formula C21H22F3NO3S and a molecular weight of 425.47 g/mol. Its IUPAC name is tert-butyl (2S,3R)-1-(4-methylphenyl)sulfinyl-3-[4-(trifluoromethyl)phenyl]aziridine-2-carboxylate.
| Compound Name | tert-butyl (2S,3R)-1-(4-methylphenyl)sulfinyl-3-[4-(trifluoromethyl)phenyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 100991718 |
| Molecular Formula | C21H22F3NO3S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | tert-butyl (2S,3R)-1-(4-methylphenyl)sulfinyl-3-[4-(trifluoromethyl)phenyl]aziridine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)N2[C@H](C(=O)OC(C)(C)C)[C@H]2c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H22F3NO3S/c1-13-5-11-16(12-6-13)29(27)25-17(18(25)19(26)28-20(2,3)4)14-7-9-15(10-8-14)21(22,23)24/h5-12,17-18H,1-4H3/t17-,18+,25?,29?/m1/s1 |
| InChIKey | CNNJZQZDCDJAKS-WXPVZZDHSA-N |
| XLogP | 4.80 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|