C18H19NO5S2 — CID 100991710
methyl (2S,3S)-1-(4-methylphenyl)sulfinyl-3-(4-methylsulfonylphenyl)aziridine-2-carboxylate (PubChem CID 100991710) has the molecular formula C18H19NO5S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is methyl (2S,3S)-1-(4-methylphenyl)sulfinyl-3-(4-methylsulfonylphenyl)aziridine-2-carboxylate.
| Compound Name | methyl (2S,3S)-1-(4-methylphenyl)sulfinyl-3-(4-methylsulfonylphenyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 100991710 |
| Molecular Formula | C18H19NO5S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | methyl (2S,3S)-1-(4-methylphenyl)sulfinyl-3-(4-methylsulfonylphenyl)aziridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](c2ccc(S(C)(=O)=O)cc2)N1S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19NO5S2/c1-12-4-8-14(9-5-12)25(21)19-16(17(19)18(20)24-2)13-6-10-15(11-7-13)26(3,22)23/h4-11,16-17H,1-3H3/t16-,17-,19?,25?/m0/s1 |
| InChIKey | VXGPGQIXURKGEZ-BAQAUFEZSA-N |
| XLogP | 2.02 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|