C21H19N3O2 — CID 100992209
N-hydroxy-4-[2-(10-methylphenazin-5-yl)ethylidene]cyclohexa-2,5-dien-1-imine oxide (PubChem CID 100992209) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-hydroxy-4-[2-(10-methylphenazin-5-yl)ethylidene]cyclohexa-2,5-dien-1-imine oxide.
| Compound Name | N-hydroxy-4-[2-(10-methylphenazin-5-yl)ethylidene]cyclohexa-2,5-dien-1-imine oxide |
|---|---|
| PubChem CID | 100992209 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-hydroxy-4-[2-(10-methylphenazin-5-yl)ethylidene]cyclohexa-2,5-dien-1-imine oxide |
| SMILES | CN1c2ccccc2N(CC=C2C=CC(=[N+]([O-])O)C=C2)c2ccccc21 |
| InChI | InChI=1S/C21H19N3O2/c1-22-18-6-2-4-8-20(18)23(21-9-5-3-7-19(21)22)15-14-16-10-12-17(13-11-16)24(25)26/h2-14H,15H2,1H3,(H,25,26) |
| InChIKey | LGQCLMXWZOHWTN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|